C12H13LiN2Se — CID 102492610
lithium 1-(2,4,6-trimethylphenyl)imidazole-2-selenolate (PubChem CID 102492610) has the molecular formula C12H13LiN2Se and a molecular weight of 271.15 g/mol. Its IUPAC name is lithium 1-(2,4,6-trimethylphenyl)imidazole-2-selenolate.
| Compound Name | lithium 1-(2,4,6-trimethylphenyl)imidazole-2-selenolate |
|---|---|
| PubChem CID | 102492610 |
| Molecular Formula | C12H13LiN2Se |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | lithium 1-(2,4,6-trimethylphenyl)imidazole-2-selenolate |
| SMILES | Cc1cc(C)c(-n2ccnc2[Se-])c(C)c1.[Li+] |
| InChI | InChI=1S/C12H14N2Se.Li/c1-8-6-9(2)11(10(3)7-8)14-5-4-13-12(14)15;/h4-7H,1-3H3,(H,13,15);/q;+1/p-1 |
| InChIKey | DWAKAZSFLRWMPB-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|