C9H10N2O — CID 130064831
7-methoxy-5-methylimidazo[1,2-a]pyridine (PubChem CID 130064831) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 7-methoxy-5-methylimidazo[1,2-a]pyridine.
| Compound Name | 7-methoxy-5-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 130064831 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 7-methoxy-5-methylimidazo[1,2-a]pyridine |
| SMILES | COc1cc(C)n2ccnc2c1 |
| InChI | InChI=1S/C9H10N2O/c1-7-5-8(12-2)6-9-10-3-4-11(7)9/h3-6H,1-2H3 |
| InChIKey | MFRIAZZOQZWSAR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |