C23H19IrN2O- — CID 58947249
1-(2,6-dimethyl-4-phenoxyphenyl)-2-phenylimidazole;iridium (PubChem CID 58947249) has the molecular formula C23H19IrN2O- and a molecular weight of 531.64 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-phenoxyphenyl)-2-phenylimidazole;iridium.
| Compound Name | 1-(2,6-dimethyl-4-phenoxyphenyl)-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58947249 |
| Molecular Formula | C23H19IrN2O- |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 1-(2,6-dimethyl-4-phenoxyphenyl)-2-phenylimidazole;iridium |
| SMILES | Cc1cc(Oc2ccccc2)cc(C)c1-n1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C23H19N2O.Ir/c1-17-15-21(26-20-11-7-4-8-12-20)16-18(2)22(17)25-14-13-24-23(25)19-9-5-3-6-10-19;/h3-9,11-16H,1-2H3;/q-1; |
| InChIKey | OJEWYBSGKRSRJB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|