C21H24IrN2O-2 — CID 155610263
butan-2-ol;1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium (PubChem CID 155610263) has the molecular formula C21H24IrN2O-2 and a molecular weight of 512.65 g/mol. Its IUPAC name is butan-2-ol;1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium.
| Compound Name | butan-2-ol;1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 155610263 |
| Molecular Formula | C21H24IrN2O-2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | butan-2-ol;1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium |
| SMILES | Cc1cccc(C)c1-n1ccnc1-c1[c-]cccc1.[CH2-]CC(C)O.[Ir] |
| InChI | InChI=1S/C17H15N2.C4H9O.Ir/c1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15;1-3-4(2)5;/h3-9,11-12H,1-2H3;4-5H,1,3H2,2H3;/q2*-1; |
| InChIKey | VNXYVEXLFGJSKT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|