C36H39BN2 — CID 140712688
bis(2,4,6-trimethylphenyl)-[3-[5-(2,4,6-trimethylphenyl)pyrazol-1-yl]phenyl]borane (PubChem CID 140712688) has the molecular formula C36H39BN2 and a molecular weight of 510.53 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)-[3-[5-(2,4,6-trimethylphenyl)pyrazol-1-yl]phenyl]borane.
| Compound Name | bis(2,4,6-trimethylphenyl)-[3-[5-(2,4,6-trimethylphenyl)pyrazol-1-yl]phenyl]borane |
|---|---|
| PubChem CID | 140712688 |
| Molecular Formula | C36H39BN2 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)-[3-[5-(2,4,6-trimethylphenyl)pyrazol-1-yl]phenyl]borane |
| SMILES | Cc1cc(C)c(B(c2cccc(-n3nccc3-c3c(C)cc(C)cc3C)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H39BN2/c1-22-15-25(4)34(26(5)16-22)33-13-14-38-39(33)32-12-10-11-31(21-32)37(35-27(6)17-23(2)18-28(35)7)36-29(8)19-24(3)20-30(36)9/h10-21H,1-9H3 |
| InChIKey | RAMVSSVLQQOINR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|