C58H58B2 — CID 102031859
[4-[8-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 102031859) has the molecular formula C58H58B2 and a molecular weight of 776.73 g/mol. Its IUPAC name is [4-[8-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[8-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 102031859 |
| Molecular Formula | C58H58B2 |
| Molecular Weight | 776.73 g/mol |
| Exact Mass | 776.47 |
| IUPAC Name | [4-[8-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]naphthalen-1-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3cccc4cccc(-c5ccc(B(c6c(C)cc(C)cc6C)c6c(C)cc(C)cc6C)cc5)c34)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C58H58B2/c1-35-27-39(5)55(40(6)28-35)59(56-41(7)29-36(2)30-42(56)8)50-23-19-47(20-24-50)52-17-13-15-49-16-14-18-53(54(49)52)48-21-25-51(26-22-48)60(57-43(9)31-37(3)32-44(57)10)58-45(11)33-38(4)34-46(58)12/h13-34H,1-12H3 |
| InChIKey | VSPMCVLTVXLJRS-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.73 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|