C33H37B — CID 163998435
[4-(3,5-dimethylphenyl)phenyl]-(2,3,4,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)borane (PubChem CID 163998435) has the molecular formula C33H37B and a molecular weight of 444.47 g/mol. Its IUPAC name is [4-(3,5-dimethylphenyl)phenyl]-(2,3,4,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-(3,5-dimethylphenyl)phenyl]-(2,3,4,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 163998435 |
| Molecular Formula | C33H37B |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | [4-(3,5-dimethylphenyl)phenyl]-(2,3,4,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)cc(-c2ccc(B(c3c(C)cc(C)cc3C)c3c(C)cc(C)c(C)c3C)cc2)c1 |
| InChI | InChI=1S/C33H37B/c1-20-14-21(2)18-30(17-20)29-10-12-31(13-11-29)34(32-24(5)15-22(3)16-25(32)6)33-26(7)19-23(4)27(8)28(33)9/h10-19H,1-9H3 |
| InChIKey | UGUDNYZUJATKDS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|