C73H68B2 — CID 102599898
[4-[7-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-9,9-diphenylfluoren-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 102599898) has the molecular formula C73H68B2 and a molecular weight of 966.97 g/mol. Its IUPAC name is [4-[7-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-9,9-diphenylfluoren-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[7-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-9,9-diphenylfluoren-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 102599898 |
| Molecular Formula | C73H68B2 |
| Molecular Weight | 966.97 g/mol |
| Exact Mass | 966.55 |
| IUPAC Name | [4-[7-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-9,9-diphenylfluoren-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(-c5ccc(B(c6c(C)cc(C)cc6C)c6c(C)cc(C)cc6C)cc5)ccc3-4)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C73H68B2/c1-45-35-49(5)69(50(6)36-45)74(70-51(7)37-46(2)38-52(70)8)63-29-23-57(24-30-63)59-27-33-65-66-34-28-60(44-68(66)73(67(65)43-59,61-19-15-13-16-20-61)62-21-17-14-18-22-62)58-25-31-64(32-26-58)75(71-53(9)39-47(3)40-54(71)10)72-55(11)41-48(4)42-56(72)12/h13-44H,1-12H3 |
| InChIKey | JOSYVWIHUUBOIV-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.97 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|