C61H58B2 — CID 123559621
[6-bis(2,4,6-trimethylphenyl)boranyl-9,9'-spirobi[fluorene]-3-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 123559621) has the molecular formula C61H58B2 and a molecular weight of 812.76 g/mol. Its IUPAC name is [6-bis(2,4,6-trimethylphenyl)boranyl-9,9'-spirobi[fluorene]-3-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [6-bis(2,4,6-trimethylphenyl)boranyl-9,9'-spirobi[fluorene]-3-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 123559621 |
| Molecular Formula | C61H58B2 |
| Molecular Weight | 812.76 g/mol |
| Exact Mass | 812.47 |
| IUPAC Name | [6-bis(2,4,6-trimethylphenyl)boranyl-9,9'-spirobi[fluorene]-3-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)-c2cc(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)ccc2C32c3ccccc3-c3ccccc32)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C61H58B2/c1-35-25-39(5)57(40(6)26-35)62(58-41(7)27-36(2)28-42(58)8)47-21-23-55-51(33-47)52-34-48(22-24-56(52)61(55)53-19-15-13-17-49(53)50-18-14-16-20-54(50)61)63(59-43(9)29-37(3)30-44(59)10)60-45(11)31-38(4)32-46(60)12/h13-34H,1-12H3 |
| InChIKey | INFKWXWXNWSSRH-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.76 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|