C69H74B2 — CID 22389524
[7-bis(2,4,6-trimethylphenyl)boranyl-2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 22389524) has the molecular formula C69H74B2 and a molecular weight of 924.97 g/mol. Its IUPAC name is [7-bis(2,4,6-trimethylphenyl)boranyl-2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [7-bis(2,4,6-trimethylphenyl)boranyl-2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 22389524 |
| Molecular Formula | C69H74B2 |
| Molecular Weight | 924.97 g/mol |
| Exact Mass | 924.60 |
| IUPAC Name | [7-bis(2,4,6-trimethylphenyl)boranyl-2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)C2(c4cc(B(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)ccc4-3)c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C69H74B2/c1-39-27-43(5)63(44(6)28-39)70(64-45(7)29-40(2)30-46(64)8)53-21-25-57-58-26-22-54(71(65-47(9)31-41(3)32-48(65)10)66-49(11)33-42(4)34-50(66)12)38-62(58)69(61(57)37-53)59-35-51(67(13,14)15)19-23-55(59)56-24-20-52(36-60(56)69)68(16,17)18/h19-38H,1-18H3 |
| InChIKey | NKVKEEOUEIWVNP-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.97 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|