C81H70N4 — CID 58141937
5-[9-[3,5-bis(N-phenylanilino)phenyl]-2,7-ditert-butylfluoren-9-yl]-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine (PubChem CID 58141937) has the molecular formula C81H70N4 and a molecular weight of 1099.48 g/mol. Its IUPAC name is 5-[9-[3,5-bis(N-phenylanilino)phenyl]-2,7-ditert-butylfluoren-9-yl]-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine.
| Compound Name | 5-[9-[3,5-bis(N-phenylanilino)phenyl]-2,7-ditert-butylfluoren-9-yl]-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 58141937 |
| Molecular Formula | C81H70N4 |
| Molecular Weight | 1099.48 g/mol |
| Exact Mass | 1098.56 |
| IUPAC Name | 5-[9-[3,5-bis(N-phenylanilino)phenyl]-2,7-ditert-butylfluoren-9-yl]-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cc(N(c3ccccc3)c3ccccc3)cc(N(c3ccccc3)c3ccccc3)c1)(c1cc(N(c3ccccc3)c3ccccc3)cc(N(c3ccccc3)c3ccccc3)c1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C81H70N4/c1-79(2,3)59-47-49-75-76-50-48-60(80(4,5)6)56-78(76)81(77(75)55-59,61-51-71(82(63-31-15-7-16-32-63)64-33-17-8-18-34-64)57-72(52-61)83(65-35-19-9-20-36-65)66-37-21-10-22-38-66)62-53-73(84(67-39-23-11-24-40-67)68-41-25-12-26-42-68)58-74(54-62)85(69-43-27-13-28-44-69)70-45-29-14-30-46-70/h7-58H,1-6H3 |
| InChIKey | TXRAFAFDFZIDFY-UHFFFAOYSA-N |
| XLogP | 22.52 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.48 |
| LogP ≤ 5 | 22.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |