C43H39NO — CID 156635050
2,6-ditert-butyl-N,N-diphenylspiro[fluorene-9,4'-indeno[2,1-b]furan]-6'-amine (PubChem CID 156635050) has the molecular formula C43H39NO and a molecular weight of 585.79 g/mol. Its IUPAC name is 2,6-ditert-butyl-N,N-diphenylspiro[fluorene-9,4'-indeno[2,1-b]furan]-6'-amine.
| Compound Name | 2,6-ditert-butyl-N,N-diphenylspiro[fluorene-9,4'-indeno[2,1-b]furan]-6'-amine |
|---|---|
| PubChem CID | 156635050 |
| Molecular Formula | C43H39NO |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 2,6-ditert-butyl-N,N-diphenylspiro[fluorene-9,4'-indeno[2,1-b]furan]-6'-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1ccc(C(C)(C)C)cc1C21c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccoc21 |
| InChI | InChI=1S/C43H39NO/c1-41(2,3)28-18-22-37-36(25-28)34-20-17-29(42(4,5)6)26-38(34)43(37)39-27-32(19-21-33(39)35-23-24-45-40(35)43)44(30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-27H,1-6H3 |
| InChIKey | UFJARHXASQKSHX-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |