C53H50B2 — CID 91289073
[4-[2-[7-bis(2,4,6-trimethylphenyl)boranyl-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]-diphenylborane (PubChem CID 91289073) has the molecular formula C53H50B2 and a molecular weight of 708.61 g/mol. Its IUPAC name is [4-[2-[7-bis(2,4,6-trimethylphenyl)boranyl-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]-diphenylborane.
| Compound Name | [4-[2-[7-bis(2,4,6-trimethylphenyl)boranyl-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]-diphenylborane |
|---|---|
| PubChem CID | 91289073 |
| Molecular Formula | C53H50B2 |
| Molecular Weight | 708.61 g/mol |
| Exact Mass | 708.41 |
| IUPAC Name | [4-[2-[7-bis(2,4,6-trimethylphenyl)boranyl-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]-diphenylborane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)C(C)(C)c2cc(C=Cc4ccc(B(c5ccccc5)c5ccccc5)cc4)ccc2-3)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C53H50B2/c1-35-29-37(3)51(38(4)30-35)55(52-39(5)31-36(2)32-40(52)6)46-26-28-48-47-27-23-42(33-49(47)53(7,8)50(48)34-46)20-19-41-21-24-45(25-22-41)54(43-15-11-9-12-16-43)44-17-13-10-14-18-44/h9-34H,1-8H3 |
| InChIKey | GXYBBGMEEFQMIF-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.61 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|