C39H41B — CID 102047135
bis(2,4,6-trimethylphenyl)-[4-[4-(2,4,6-trimethylphenyl)phenyl]phenyl]borane (PubChem CID 102047135) has the molecular formula C39H41B and a molecular weight of 520.57 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)-[4-[4-(2,4,6-trimethylphenyl)phenyl]phenyl]borane.
| Compound Name | bis(2,4,6-trimethylphenyl)-[4-[4-(2,4,6-trimethylphenyl)phenyl]phenyl]borane |
|---|---|
| PubChem CID | 102047135 |
| Molecular Formula | C39H41B |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)-[4-[4-(2,4,6-trimethylphenyl)phenyl]phenyl]borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3ccc(-c4c(C)cc(C)cc4C)cc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C39H41B/c1-24-18-27(4)37(28(5)19-24)35-12-10-33(11-13-35)34-14-16-36(17-15-34)40(38-29(6)20-25(2)21-30(38)7)39-31(8)22-26(3)23-32(39)9/h10-23H,1-9H3 |
| InChIKey | UXXRIMQNQWDPSO-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|