C63H60B2N2 — CID 59211458
[4-[2-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-11,17-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 59211458) has the molecular formula C63H60B2N2 and a molecular weight of 866.81 g/mol. Its IUPAC name is [4-[2-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-11,17-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[2-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-11,17-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 59211458 |
| Molecular Formula | C63H60B2N2 |
| Molecular Weight | 866.81 g/mol |
| Exact Mass | 866.49 |
| IUPAC Name | [4-[2-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-11,17-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3c4ccccc4c(-c4ccc(B(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)cc4)c4c3nc3ccccn34)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C63H60B2N2/c1-37-29-41(5)58(42(6)30-37)64(59-43(7)31-38(2)32-44(59)8)51-24-20-49(21-25-51)56-53-17-13-14-18-54(53)57(63-62(56)66-55-19-15-16-28-67(55)63)50-22-26-52(27-23-50)65(60-45(9)33-39(3)34-46(60)10)61-47(11)35-40(4)36-48(61)12/h13-36H,1-12H3 |
| InChIKey | IOLBQLVRMWBINR-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.81 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|