C30H24N2O — CID 132562122
5-methoxy-8,9-bis(4-methylphenyl)-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene (PubChem CID 132562122) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-methoxy-8,9-bis(4-methylphenyl)-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene.
| Compound Name | 5-methoxy-8,9-bis(4-methylphenyl)-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
|---|---|
| PubChem CID | 132562122 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-methoxy-8,9-bis(4-methylphenyl)-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
| SMILES | COc1ccc2c(c1)c(-c1ccc(C)cc1)c(-c1ccc(C)cc1)c1c2nc2ccccn21 |
| InChI | InChI=1S/C30H24N2O/c1-19-7-11-21(12-8-19)27-25-18-23(33-3)15-16-24(25)29-30(32-17-5-4-6-26(32)31-29)28(27)22-13-9-20(2)10-14-22/h4-18H,1-3H3 |
| InChIKey | ZGORDFSRCQOLBQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |