C64H56BNSi — CID 101432253
N-[4-[4-[[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-diphenylsilyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine (PubChem CID 101432253) has the molecular formula C64H56BNSi and a molecular weight of 878.06 g/mol. Its IUPAC name is N-[4-[4-[[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-diphenylsilyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine.
| Compound Name | N-[4-[4-[[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-diphenylsilyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 101432253 |
| Molecular Formula | C64H56BNSi |
| Molecular Weight | 878.06 g/mol |
| Exact Mass | 877.43 |
| IUPAC Name | N-[4-[4-[[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-diphenylsilyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| SMILES | Cc1cc(C)c(B(c2ccc([Si](c3ccccc3)(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5cccc6ccccc56)cc4)cc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C64H56BNSi/c1-45-41-47(3)63(48(4)42-45)65(64-49(5)43-46(2)44-50(64)6)54-33-39-60(40-34-54)67(57-23-12-8-13-24-57,58-25-14-9-15-26-58)59-37-31-52(32-38-59)51-29-35-56(36-30-51)66(55-21-10-7-11-22-55)62-28-18-20-53-19-16-17-27-61(53)62/h7-44H,1-6H3 |
| InChIKey | YNQOEYMYBWTLSP-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.06 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|