C57H49BN4 — CID 177074002
N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-amine (PubChem CID 177074002) has the molecular formula C57H49BN4 and a molecular weight of 800.86 g/mol. Its IUPAC name is N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177074002 |
| Molecular Formula | C57H49BN4 |
| Molecular Weight | 800.86 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(B(c2ccc(N(c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)c3ccccc3-c3ccccc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C57H49BN4/c1-38-34-40(3)53(41(4)35-38)58(54-42(5)36-39(2)37-43(54)6)49-30-32-50(33-31-49)62(52-25-17-16-24-51(52)46-20-12-8-13-21-46)57-60-55(47-22-14-9-15-23-47)59-56(61-57)48-28-26-45(27-29-48)44-18-10-7-11-19-44/h7-37H,1-6H3 |
| InChIKey | QVEZHFVZPIMULN-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.86 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|