C50H44BN3 — CID 177074160
N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(3-phenylnaphthalen-2-yl)pyrimidin-2-amine (PubChem CID 177074160) has the molecular formula C50H44BN3 and a molecular weight of 697.74 g/mol. Its IUPAC name is N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(3-phenylnaphthalen-2-yl)pyrimidin-2-amine.
| Compound Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(3-phenylnaphthalen-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 177074160 |
| Molecular Formula | C50H44BN3 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.36 |
| IUPAC Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-phenyl-N-(3-phenylnaphthalen-2-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(C)c(B(c2ccc(N(c3nccc(-c4ccccc4)n3)c3cc4ccccc4cc3-c3ccccc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C50H44BN3/c1-33-27-35(3)48(36(4)28-33)51(49-37(5)29-34(2)30-38(49)6)43-21-23-44(24-22-43)54(50-52-26-25-46(53-50)40-17-11-8-12-18-40)47-32-42-20-14-13-19-41(42)31-45(47)39-15-9-7-10-16-39/h7-32H,1-6H3 |
| InChIKey | PNLJLPHNLAZEIT-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|