C67H55BN4 — CID 177073721
N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-(3-phenylnaphthalen-2-yl)-1,3,5-triazin-2-amine (PubChem CID 177073721) has the molecular formula C67H55BN4 and a molecular weight of 927.02 g/mol. Its IUPAC name is N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-(3-phenylnaphthalen-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-(3-phenylnaphthalen-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177073721 |
| Molecular Formula | C67H55BN4 |
| Molecular Weight | 927.02 g/mol |
| Exact Mass | 926.45 |
| IUPAC Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-(3-phenylnaphthalen-2-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(B(c2ccc(N(c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c3cc4ccccc4cc3-c3ccccc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C67H55BN4/c1-44-35-46(3)63(47(4)36-44)68(64-48(5)37-45(2)38-49(64)6)59-31-33-60(34-32-59)72(62-43-55-30-20-19-29-54(55)42-61(62)52-25-15-9-16-26-52)67-70-65(53-27-17-10-18-28-53)69-66(71-67)58-40-56(50-21-11-7-12-22-50)39-57(41-58)51-23-13-8-14-24-51/h7-43H,1-6H3 |
| InChIKey | BHPAOTMIVJKVTO-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.02 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|