C66H54N8 — CID 177074330
4-N-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-4-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N,1-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine (PubChem CID 177074330) has the molecular formula C66H54N8 and a molecular weight of 959.21 g/mol. Its IUPAC name is 4-N-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-4-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N,1-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-4-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N,1-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 177074330 |
| Molecular Formula | C66H54N8 |
| Molecular Weight | 959.21 g/mol |
| Exact Mass | 958.45 |
| IUPAC Name | 4-N-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-4-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N,1-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
| SMILES | Cc1cc(C)c(N(c2ccc(N(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C66H54N8/c1-43-36-45(3)59(46(4)37-43)73(60-47(5)38-44(2)39-48(60)6)57-32-34-58(35-33-57)74(65-69-61(51-26-16-9-17-27-51)67-62(70-65)52-28-18-10-19-29-52)66-71-63(53-30-20-11-21-31-53)68-64(72-66)56-41-54(49-22-12-7-13-23-49)40-55(42-56)50-24-14-8-15-25-50/h7-42H,1-6H3 |
| InChIKey | HZOIYYGQFZCBDH-UHFFFAOYSA-N |
| XLogP | 16.85 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.21 |
| LogP ≤ 5 | 16.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |