C67H55N7 — CID 177073755
N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4,6-diphenyl-N-[4-phenyl-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]-1,3,5-triazin-2-amine (PubChem CID 177073755) has the molecular formula C67H55N7 and a molecular weight of 958.23 g/mol. Its IUPAC name is N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4,6-diphenyl-N-[4-phenyl-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4,6-diphenyl-N-[4-phenyl-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177073755 |
| Molecular Formula | C67H55N7 |
| Molecular Weight | 958.23 g/mol |
| Exact Mass | 957.45 |
| IUPAC Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4,6-diphenyl-N-[4-phenyl-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(C(c2ccc(N(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3nc(-c4ccccc4)nc(-c4ccc(-c5cccc(-c6ccccc6)c5)cc4)n3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C67H55N7/c1-43-38-45(3)59(46(4)39-43)61(60-47(5)40-44(2)41-48(60)6)51-34-36-58(37-35-51)74(66-70-62(52-22-13-8-14-23-52)68-63(71-66)53-24-15-9-16-25-53)67-72-64(54-26-17-10-18-27-54)69-65(73-67)55-32-30-50(31-33-55)57-29-19-28-56(42-57)49-20-11-7-12-21-49/h7-42,61H,1-6H3 |
| InChIKey | TVQBXXQCLOPCOI-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.23 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|