C70H58N4 — CID 177073958
N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 177073958) has the molecular formula C70H58N4 and a molecular weight of 955.26 g/mol. Its IUPAC name is N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177073958 |
| Molecular Formula | C70H58N4 |
| Molecular Weight | 955.26 g/mol |
| Exact Mass | 954.47 |
| IUPAC Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-(3,5-diphenylphenyl)-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(C(c2ccc(N(c3ccc(-c4ccccc4-c4ccccc4)cc3)c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C70H58N4/c1-46-39-48(3)65(49(4)40-46)67(66-50(5)41-47(2)42-51(66)6)56-33-37-62(38-34-56)74(61-35-31-55(32-36-61)64-30-20-19-29-63(64)54-25-15-9-16-26-54)70-72-68(57-27-17-10-18-28-57)71-69(73-70)60-44-58(52-21-11-7-12-22-52)43-59(45-60)53-23-13-8-14-24-53/h7-45,67H,1-6H3 |
| InChIKey | PLUXJENYYAOKOI-UHFFFAOYSA-N |
| XLogP | 18.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.26 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|