C61H56N4 — CID 177073778
N-[3-[bis(2,4,6-trimethylphenyl)methyl]-2,4,6-trimethylphenyl]-4-(3,5-diphenylphenyl)-N,6-diphenyl-1,3,5-triazin-2-amine (PubChem CID 177073778) has the molecular formula C61H56N4 and a molecular weight of 845.15 g/mol. Its IUPAC name is N-[3-[bis(2,4,6-trimethylphenyl)methyl]-2,4,6-trimethylphenyl]-4-(3,5-diphenylphenyl)-N,6-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | N-[3-[bis(2,4,6-trimethylphenyl)methyl]-2,4,6-trimethylphenyl]-4-(3,5-diphenylphenyl)-N,6-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177073778 |
| Molecular Formula | C61H56N4 |
| Molecular Weight | 845.15 g/mol |
| Exact Mass | 844.45 |
| IUPAC Name | N-[3-[bis(2,4,6-trimethylphenyl)methyl]-2,4,6-trimethylphenyl]-4-(3,5-diphenylphenyl)-N,6-diphenyl-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(C(c2c(C)cc(C)cc2C)c2c(C)cc(C)c(N(c3ccccc3)c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2C)c(C)c1 |
| InChI | InChI=1S/C61H56N4/c1-38-30-40(3)54(41(4)31-38)57(55-42(5)32-39(2)33-43(55)6)56-44(7)34-45(8)58(46(56)9)65(53-28-20-13-21-29-53)61-63-59(49-26-18-12-19-27-49)62-60(64-61)52-36-50(47-22-14-10-15-23-47)35-51(37-52)48-24-16-11-17-25-48/h10-37,57H,1-9H3 |
| InChIKey | JXVGBNWQJPHHPO-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.15 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|