C49H43N5 — CID 177074144
1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-phenyl-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine (PubChem CID 177074144) has the molecular formula C49H43N5 and a molecular weight of 701.92 g/mol. Its IUPAC name is 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-phenyl-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine.
| Compound Name | 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-phenyl-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 177074144 |
| Molecular Formula | C49H43N5 |
| Molecular Weight | 701.92 g/mol |
| Exact Mass | 701.35 |
| IUPAC Name | 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-phenyl-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine |
| SMILES | Cc1cc(C)c(N(c2cccc(N(c3ccccc3)c3nc(-c4ccccc4)nc(-c4ccc5ccccc5c4)n3)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C49H43N5/c1-32-26-34(3)45(35(4)27-32)54(46-36(5)28-33(2)29-37(46)6)44-23-15-22-43(31-44)53(42-20-11-8-12-21-42)49-51-47(39-17-9-7-10-18-39)50-48(52-49)41-25-24-38-16-13-14-19-40(38)30-41/h7-31H,1-6H3 |
| InChIKey | XFKXYFURCZAGET-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.92 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |