C59H49N5 — CID 177073651
1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-(3-phenylnaphthalen-2-yl)-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine (PubChem CID 177073651) has the molecular formula C59H49N5 and a molecular weight of 828.08 g/mol. Its IUPAC name is 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-(3-phenylnaphthalen-2-yl)-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-(3-phenylnaphthalen-2-yl)-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 177073651 |
| Molecular Formula | C59H49N5 |
| Molecular Weight | 828.08 g/mol |
| Exact Mass | 827.40 |
| IUPAC Name | 1-N-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1-N-(3-phenylnaphthalen-2-yl)-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
| SMILES | Cc1cc(C)c(N(c2ccc(N(c3nc(-c4ccccc4)nc(-c4ccc5ccccc5c4)n3)c3cc4ccccc4cc3-c3ccccc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C59H49N5/c1-38-31-40(3)55(41(4)32-38)64(56-42(5)33-39(2)34-43(56)6)52-29-27-51(28-30-52)63(54-37-49-24-16-15-23-48(49)36-53(54)45-18-9-7-10-19-45)59-61-57(46-20-11-8-12-21-46)60-58(62-59)50-26-25-44-17-13-14-22-47(44)35-50/h7-37H,1-6H3 |
| InChIKey | WHPJYKBUGAUZNV-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.08 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |