C61H51N5 — CID 177074356
1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-[4-(8-phenylnaphthalen-1-yl)phenyl]-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine (PubChem CID 177074356) has the molecular formula C61H51N5 and a molecular weight of 854.11 g/mol. Its IUPAC name is 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-[4-(8-phenylnaphthalen-1-yl)phenyl]-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine.
| Compound Name | 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-[4-(8-phenylnaphthalen-1-yl)phenyl]-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 177074356 |
| Molecular Formula | C61H51N5 |
| Molecular Weight | 854.11 g/mol |
| Exact Mass | 853.41 |
| IUPAC Name | 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-[4-(8-phenylnaphthalen-1-yl)phenyl]-4-N,4-N-bis(2,4,6-trimethylphenyl)benzene-1,4-diamine |
| SMILES | Cc1cc(C)c(N(c2ccc(N(c3ccc(-c4cccc5cccc(-c6ccccc6)c45)cc3)c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C61H51N5/c1-40-36-42(3)57(43(4)37-40)66(58-44(5)38-41(2)39-45(58)6)53-34-32-52(33-35-53)65(61-63-59(49-20-12-8-13-21-49)62-60(64-61)50-22-14-9-15-23-50)51-30-28-47(29-31-51)55-27-17-25-48-24-16-26-54(56(48)55)46-18-10-7-11-19-46/h7-39H,1-6H3 |
| InChIKey | SUAUDINRSFKVQR-UHFFFAOYSA-N |
| XLogP | 16.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.11 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |