C62H52N4 — CID 177074111
N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-naphthalen-1-yl-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 177074111) has the molecular formula C62H52N4 and a molecular weight of 853.13 g/mol. Its IUPAC name is N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-naphthalen-1-yl-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-naphthalen-1-yl-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177074111 |
| Molecular Formula | C62H52N4 |
| Molecular Weight | 853.13 g/mol |
| Exact Mass | 852.42 |
| IUPAC Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-4-naphthalen-1-yl-6-phenyl-N-[4-(2-phenylphenyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(C(c2ccc(N(c3ccc(-c4ccccc4-c4ccccc4)cc3)c3nc(-c4ccccc4)nc(-c4cccc5ccccc45)n3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C62H52N4/c1-40-36-42(3)57(43(4)37-40)59(58-44(5)38-41(2)39-45(58)6)49-30-34-52(35-31-49)66(51-32-28-48(29-33-51)54-25-16-15-24-53(54)46-18-9-7-10-19-46)62-64-60(50-21-11-8-12-22-50)63-61(65-62)56-27-17-23-47-20-13-14-26-55(47)56/h7-39,59H,1-6H3 |
| InChIKey | KUIGILWWNSQYIR-UHFFFAOYSA-N |
| XLogP | 16.19 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.13 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|