C64H54N4 — CID 177074332
N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-N,4,6-tris(2-phenylphenyl)-1,3,5-triazin-2-amine (PubChem CID 177074332) has the molecular formula C64H54N4 and a molecular weight of 879.16 g/mol. Its IUPAC name is N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-N,4,6-tris(2-phenylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-N,4,6-tris(2-phenylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177074332 |
| Molecular Formula | C64H54N4 |
| Molecular Weight | 879.16 g/mol |
| Exact Mass | 878.43 |
| IUPAC Name | N-[4-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-N,4,6-tris(2-phenylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(C)c(C(c2ccc(N(c3nc(-c4ccccc4-c4ccccc4)nc(-c4ccccc4-c4ccccc4)n3)c3ccccc3-c3ccccc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C64H54N4/c1-42-38-44(3)59(45(4)39-42)61(60-46(5)40-43(2)41-47(60)6)51-34-36-52(37-35-51)68(58-33-21-20-30-55(58)50-26-14-9-15-27-50)64-66-62(56-31-18-16-28-53(56)48-22-10-7-11-23-48)65-63(67-64)57-32-19-17-29-54(57)49-24-12-8-13-25-49/h7-41,61H,1-6H3 |
| InChIKey | GDWFVAVCTOTBHV-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.16 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|