C55H47N5 — CID 177074062
1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-(1-phenylnaphthalen-2-yl)-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine (PubChem CID 177074062) has the molecular formula C55H47N5 and a molecular weight of 778.02 g/mol. Its IUPAC name is 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-(1-phenylnaphthalen-2-yl)-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine.
| Compound Name | 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-(1-phenylnaphthalen-2-yl)-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 177074062 |
| Molecular Formula | C55H47N5 |
| Molecular Weight | 778.02 g/mol |
| Exact Mass | 777.38 |
| IUPAC Name | 1-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-N-(1-phenylnaphthalen-2-yl)-3-N,3-N-bis(2,4,6-trimethylphenyl)benzene-1,3-diamine |
| SMILES | Cc1cc(C)c(N(c2cccc(N(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3ccc4ccccc4c3-c3ccccc3)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C55H47N5/c1-36-31-38(3)51(39(4)32-36)60(52-40(5)33-37(2)34-41(52)6)47-27-18-26-46(35-47)59(49-30-29-42-19-16-17-28-48(42)50(49)43-20-10-7-11-21-43)55-57-53(44-22-12-8-13-23-44)56-54(58-55)45-24-14-9-15-25-45/h7-35H,1-6H3 |
| InChIKey | QEDQRZCMYDVYCI-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.02 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |