C54H46N8 — CID 177074261
1-N,1-N-bis(3,5-dideuterio-2,4,6-trimethylphenyl)-4-N,4-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-diamine (PubChem CID 177074261) has the molecular formula C54H46N8 and a molecular weight of 811.04 g/mol. Its IUPAC name is 1-N,1-N-bis(3,5-dideuterio-2,4,6-trimethylphenyl)-4-N,4-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N-bis(3,5-dideuterio-2,4,6-trimethylphenyl)-4-N,4-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 177074261 |
| Molecular Formula | C54H46N8 |
| Molecular Weight | 811.04 g/mol |
| Exact Mass | 810.41 |
| IUPAC Name | 1-N,1-N-bis(3,5-dideuterio-2,4,6-trimethylphenyl)-4-N,4-N-bis(4,6-diphenyl-1,3,5-triazin-2-yl)benzene-1,4-diamine |
| SMILES | [2H]c1c(C)c([2H])c(C)c(N(c2ccc(N(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2c(C)c([2H])c(C)c([2H])c2C)c1C |
| InChI | InChI=1S/C54H46N8/c1-35-31-37(3)47(38(4)32-35)61(48-39(5)33-36(2)34-40(48)6)45-27-29-46(30-28-45)62(53-57-49(41-19-11-7-12-20-41)55-50(58-53)42-21-13-8-14-22-42)54-59-51(43-23-15-9-16-24-43)56-52(60-54)44-25-17-10-18-26-44/h7-34H,1-6H3/i31D,32D,33D,34D |
| InChIKey | HLQJOWIIQTZCDO-FQFBMFJUSA-N |
| XLogP | 13.51 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.04 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |