C59H51N3 — CID 177074405
2-[[3-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-(3,5-diphenylphenyl)methyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 177074405) has the molecular formula C59H51N3 and a molecular weight of 802.08 g/mol. Its IUPAC name is 2-[[3-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-(3,5-diphenylphenyl)methyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[[3-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-(3,5-diphenylphenyl)methyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177074405 |
| Molecular Formula | C59H51N3 |
| Molecular Weight | 802.08 g/mol |
| Exact Mass | 801.41 |
| IUPAC Name | 2-[[3-[bis(2,4,6-trimethylphenyl)methyl]phenyl]-(3,5-diphenylphenyl)methyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(C)c(C(c2cccc(C(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C59H51N3/c1-38-30-40(3)53(41(4)31-38)56(54-42(5)32-39(2)33-43(54)6)49-29-19-28-48(34-49)55(52-36-50(44-20-11-7-12-21-44)35-51(37-52)45-22-13-8-14-23-45)59-61-57(46-24-15-9-16-25-46)60-58(62-59)47-26-17-10-18-27-47/h7-37,55-56H,1-6H3 |
| InChIKey | OTXWUYDBERPCRC-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.08 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|