C44H40BN3 — CID 177073913
N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-N-(3-pyrazin-2-ylphenyl)naphthalen-2-amine (PubChem CID 177073913) has the molecular formula C44H40BN3 and a molecular weight of 621.64 g/mol. Its IUPAC name is N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-N-(3-pyrazin-2-ylphenyl)naphthalen-2-amine.
| Compound Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-N-(3-pyrazin-2-ylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 177073913 |
| Molecular Formula | C44H40BN3 |
| Molecular Weight | 621.64 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | N-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-N-(3-pyrazin-2-ylphenyl)naphthalen-2-amine |
| SMILES | Cc1cc(C)c(B(c2ccc(N(c3cccc(-c4cnccn4)c3)c3ccc4ccccc4c3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C44H40BN3/c1-29-22-31(3)43(32(4)23-29)45(44-33(5)24-30(2)25-34(44)6)38-15-18-39(19-16-38)48(41-17-14-35-10-7-8-11-36(35)26-41)40-13-9-12-37(27-40)42-28-46-20-21-47-42/h7-28H,1-6H3 |
| InChIKey | MFOWLWTZHQTGCU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.64 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|