C18H19N3 — CID 139251579
1-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)triazole (PubChem CID 139251579) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)triazole.
| Compound Name | 1-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)triazole |
|---|---|
| PubChem CID | 139251579 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)triazole |
| SMILES | Cc1ccc(-n2nncc2-c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H19N3/c1-12-5-7-16(8-6-12)21-17(11-19-20-21)18-14(3)9-13(2)10-15(18)4/h5-11H,1-4H3 |
| InChIKey | QKVHLYUFZZNUAC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |