C22H16Cl2N4O — CID 16652236
N-(2,5-dichlorophenyl)-4-[5-(4-methylphenyl)triazol-1-yl]benzamide (PubChem CID 16652236) has the molecular formula C22H16Cl2N4O and a molecular weight of 423.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-[5-(4-methylphenyl)triazol-1-yl]benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-[5-(4-methylphenyl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 16652236 |
| Molecular Formula | C22H16Cl2N4O |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-[5-(4-methylphenyl)triazol-1-yl]benzamide |
| SMILES | Cc1ccc(-c2cnnn2-c2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl2N4O/c1-14-2-4-15(5-3-14)21-13-25-27-28(21)18-9-6-16(7-10-18)22(29)26-20-12-17(23)8-11-19(20)24/h2-13H,1H3,(H,26,29) |
| InChIKey | RFFZITSNHLSWNF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |