C23H19FN4O3 — CID 16652343
N-(2,5-dimethoxyphenyl)-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide (PubChem CID 16652343) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 16652343 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(-n3nncc3-c3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C23H19FN4O3/c1-30-19-11-12-22(31-2)20(13-19)26-23(29)16-5-9-18(10-6-16)28-21(14-25-27-28)15-3-7-17(24)8-4-15/h3-14H,1-2H3,(H,26,29) |
| InChIKey | CXIXENDLYOCUJL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |