C25H21FN4O3 — CID 16652359
propyl 4-[[4-[5-(4-fluorophenyl)triazol-1-yl]benzoyl]amino]benzoate (PubChem CID 16652359) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is propyl 4-[[4-[5-(4-fluorophenyl)triazol-1-yl]benzoyl]amino]benzoate.
| Compound Name | propyl 4-[[4-[5-(4-fluorophenyl)triazol-1-yl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 16652359 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | propyl 4-[[4-[5-(4-fluorophenyl)triazol-1-yl]benzoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2ccc(-n3nncc3-c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H21FN4O3/c1-2-15-33-25(32)19-5-11-21(12-6-19)28-24(31)18-7-13-22(14-8-18)30-23(16-27-29-30)17-3-9-20(26)10-4-17/h3-14,16H,2,15H2,1H3,(H,28,31) |
| InChIKey | ZUCPNFFLTDRJAO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |