C21H21N3O3 — CID 55771754
propyl 4-[[4-(4-methylpyrazol-1-yl)benzoyl]amino]benzoate (PubChem CID 55771754) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is propyl 4-[[4-(4-methylpyrazol-1-yl)benzoyl]amino]benzoate.
| Compound Name | propyl 4-[[4-(4-methylpyrazol-1-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 55771754 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | propyl 4-[[4-(4-methylpyrazol-1-yl)benzoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2ccc(-n3cc(C)cn3)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-3-12-27-21(26)17-4-8-18(9-5-17)23-20(25)16-6-10-19(11-7-16)24-14-15(2)13-22-24/h4-11,13-14H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | YWAWONHEXXZJSN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |