C18H18N4O4S — CID 11326630
propyl 4-[5-(4-sulfamoylphenyl)triazol-1-yl]benzoate (PubChem CID 11326630) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is propyl 4-[5-(4-sulfamoylphenyl)triazol-1-yl]benzoate.
| Compound Name | propyl 4-[5-(4-sulfamoylphenyl)triazol-1-yl]benzoate |
|---|---|
| PubChem CID | 11326630 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | propyl 4-[5-(4-sulfamoylphenyl)triazol-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(-n2nncc2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H18N4O4S/c1-2-11-26-18(23)14-3-7-15(8-4-14)22-17(12-20-21-22)13-5-9-16(10-6-13)27(19,24)25/h3-10,12H,2,11H2,1H3,(H2,19,24,25) |
| InChIKey | UKOIPWCRUDQNHO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |