C24H21ClN4O — CID 16652420
4-[5-(4-chlorophenyl)triazol-1-yl]-N-(2-ethyl-6-methylphenyl)benzamide (PubChem CID 16652420) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)triazol-1-yl]-N-(2-ethyl-6-methylphenyl)benzamide.
| Compound Name | 4-[5-(4-chlorophenyl)triazol-1-yl]-N-(2-ethyl-6-methylphenyl)benzamide |
|---|---|
| PubChem CID | 16652420 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[5-(4-chlorophenyl)triazol-1-yl]-N-(2-ethyl-6-methylphenyl)benzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1ccc(-n2nncc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN4O/c1-3-17-6-4-5-16(2)23(17)27-24(30)19-9-13-21(14-10-19)29-22(15-26-28-29)18-7-11-20(25)12-8-18/h4-15H,3H2,1-2H3,(H,27,30) |
| InChIKey | RQIFJNUROJSEGT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |