C22H16ClFN4O — CID 16652348
N-[(2-chlorophenyl)methyl]-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide (PubChem CID 16652348) has the molecular formula C22H16ClFN4O and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 16652348 |
| Molecular Formula | C22H16ClFN4O |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[5-(4-fluorophenyl)triazol-1-yl]benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(-n2nncc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H16ClFN4O/c23-20-4-2-1-3-17(20)13-25-22(29)16-7-11-19(12-8-16)28-21(14-26-27-28)15-5-9-18(24)10-6-15/h1-12,14H,13H2,(H,25,29) |
| InChIKey | PEZMTHLZVNKATF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |