C15H11ClFN5O — CID 27548864
4-chloro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide (PubChem CID 27548864) has the molecular formula C15H11ClFN5O and a molecular weight of 331.74 g/mol. Its IUPAC name is 4-chloro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 27548864 |
| Molecular Formula | C15H11ClFN5O |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-chloro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide |
| SMILES | O=C(NCc1nnnn1-c1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClFN5O/c16-11-3-1-10(2-4-11)15(23)18-9-14-19-20-21-22(14)13-7-5-12(17)6-8-13/h1-8H,9H2,(H,18,23) |
| InChIKey | JLKKJMWGUIUXSC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |