C15H10ClF2N5O — CID 18565796
2-chloro-6-fluoro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide (PubChem CID 18565796) has the molecular formula C15H10ClF2N5O and a molecular weight of 349.73 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 18565796 |
| Molecular Formula | C15H10ClF2N5O |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-chloro-6-fluoro-N-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]benzamide |
| SMILES | O=C(NCc1nnnn1-c1ccc(F)cc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H10ClF2N5O/c16-11-2-1-3-12(18)14(11)15(24)19-8-13-20-21-22-23(13)10-6-4-9(17)5-7-10/h1-7H,8H2,(H,19,24) |
| InChIKey | ZPJGGWPHCANXHZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |