C28H23IrN3-2 — CID 170539583
3-(3,5-dimethylphenyl)-1-phenylpyrazole;iridium;2-phenylpyridine (PubChem CID 170539583) has the molecular formula C28H23IrN3-2 and a molecular weight of 593.73 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-phenylpyrazole;iridium;2-phenylpyridine.
| Compound Name | 3-(3,5-dimethylphenyl)-1-phenylpyrazole;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 170539583 |
| Molecular Formula | C28H23IrN3-2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-phenylpyrazole;iridium;2-phenylpyridine |
| SMILES | Cc1cc(C)cc(-c2ccn(-c3[c-]cccc3)n2)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H15N2.C11H8N.Ir/c1-13-10-14(2)12-15(11-13)17-8-9-19(18-17)16-6-4-3-5-7-16;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-6,8-12H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | QGEOSJXPJHIOTJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|