About CID 59340238
CID 59340238 (PubChem CID 59340238) has the molecular formula C12H9IrN2-
and a molecular weight of 373.44 g/mol.
Molecular Properties
| Compound Name | CID 59340238 |
| PubChem CID | 59340238 |
| Molecular Formula | C12H9IrN2- |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | — |
| SMILES | [CH]Cc1nccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C12H9N2.Ir/c1-2-12-13-9-8-11(14-12)10-6-4-3-5-7-10;/h1,3-6,8-9H,2H2;/q-1; |
| InChIKey | XAEQSCGZJBMZFV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59340238 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59340238?
The IUPAC name of CID 59340238 (CID 59340238) is not available.
What is the SMILES notation for CID 59340238?
The canonical SMILES for CID 59340238 is [CH]Cc1nccc(-c2[c-]cccc2)n1.[Ir].
What is the InChIKey of CID 59340238?
The InChIKey is XAEQSCGZJBMZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N2.Ir/c1-2-12-13-9-8-11(14-12)10-6-4-3-5-7-10;/h1,3-6,8-9H,2H2;/q-1;.
What are the key properties of CID 59340238?
CID 59340238 has a molecular weight of 373.44 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59340238 is sourced from PubChem (CID 59340238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).