About 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium
2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium (PubChem CID 59399308) has the molecular formula C17H12N2PtY-2
and a molecular weight of 528.28 g/mol. Its IUPAC name is 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium.
Molecular Properties
| Compound Name | 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium |
| PubChem CID | 59399308 |
| Molecular Formula | C17H12N2PtY-2 |
| Molecular Weight | 528.28 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium |
| SMILES | [Pt].[Y].[c-]1cccc(Cc2cccc(-c3[c-]cccc3)n2)n1 |
| InChI | InChI=1S/C17H12N2.Pt.Y/c1-2-7-14(8-3-1)17-11-6-10-16(19-17)13-15-9-4-5-12-18-15;;/h1-7,9-11H,13H2;;/q-2;; |
| InChIKey | YJAQDDGWXCWGCR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium?
The IUPAC name of 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium (CID 59399308) is 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium.
What is the SMILES notation for 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium?
The canonical SMILES for 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium is [Pt].[Y].[c-]1cccc(Cc2cccc(-c3[c-]cccc3)n2)n1.
What is the InChIKey of 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium?
The InChIKey is YJAQDDGWXCWGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2.Pt.Y/c1-2-7-14(8-3-1)17-11-6-10-16(19-17)13-15-9-4-5-12-18-15;;/h1-7,9-11H,13H2;;/q-2;;.
What are the key properties of 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium?
2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium has a molecular weight of 528.28 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-(2H-pyridin-2-id-6-ylmethyl)pyridine;platinum;yttrium is sourced from PubChem (CID 59399308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).