C24H18NO2OsP+ — CID 140807958
2-(benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-ylmethyl)-6-phenylpyridine;osmium(1+) (PubChem CID 140807958) has the molecular formula C24H18NO2OsP+ and a molecular weight of 573.62 g/mol. Its IUPAC name is 2-(benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-ylmethyl)-6-phenylpyridine;osmium(1+).
| Compound Name | 2-(benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-ylmethyl)-6-phenylpyridine;osmium(1+) |
|---|---|
| PubChem CID | 140807958 |
| Molecular Formula | C24H18NO2OsP+ |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | 2-(benzo[d][1,3,2]benzodioxaphosphepin-6-ium-6-ylmethyl)-6-phenylpyridine;osmium(1+) |
| SMILES | [Os+].[c-]1ccccc1-c1cccc(C[PH+]2Oc3ccccc3-c3ccccc3O2)n1 |
| InChI | InChI=1S/C24H17NO2P.Os/c1-2-9-18(10-3-1)22-14-8-11-19(25-22)17-28-26-23-15-6-4-12-20(23)21-13-5-7-16-24(21)27-28;/h1-9,11-16H,17H2;/q-1;+1/p+1 |
| InChIKey | BPFAVCKHOXKJAM-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|