C64H40N2Pt — CID 155620139
2-[2,2-bis(4-naphthalen-1-ylnaphthalen-1-yl)-1-(6-phenyl-2-pyridinyl)ethenyl]-6-phenylpyridine;platinum(2+) (PubChem CID 155620139) has the molecular formula C64H40N2Pt and a molecular weight of 1032.12 g/mol. Its IUPAC name is 2-[2,2-bis(4-naphthalen-1-ylnaphthalen-1-yl)-1-(6-phenyl-2-pyridinyl)ethenyl]-6-phenylpyridine;platinum(2+).
| Compound Name | 2-[2,2-bis(4-naphthalen-1-ylnaphthalen-1-yl)-1-(6-phenyl-2-pyridinyl)ethenyl]-6-phenylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 155620139 |
| Molecular Formula | C64H40N2Pt |
| Molecular Weight | 1032.12 g/mol |
| Exact Mass | 1031.28 |
| IUPAC Name | 2-[2,2-bis(4-naphthalen-1-ylnaphthalen-1-yl)-1-(6-phenyl-2-pyridinyl)ethenyl]-6-phenylpyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(C(=C(c2ccc(-c3cccc4ccccc34)c3ccccc23)c2ccc(-c3cccc4ccccc34)c3ccccc23)c2cccc(-c3[c-]cccc3)n2)n1 |
| InChI | InChI=1S/C64H40N2.Pt/c1-3-21-45(22-4-1)59-35-17-37-61(65-59)64(62-38-18-36-60(66-62)46-23-5-2-6-24-46)63(57-41-39-55(51-29-11-13-31-53(51)57)49-33-15-25-43-19-7-9-27-47(43)49)58-42-40-56(52-30-12-14-32-54(52)58)50-34-16-26-44-20-8-10-28-48(44)50;/h1-21,23,25-42H;/q-2;+2 |
| InChIKey | VDQZGILSJWOPBV-UHFFFAOYSA-N |
| XLogP | 16.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.12 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|