C38H23FIrN2O-2 — CID 165386052
2-(7-fluoro-6-naphthalen-1-yl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 165386052) has the molecular formula C38H23FIrN2O-2 and a molecular weight of 734.83 g/mol. Its IUPAC name is 2-(7-fluoro-6-naphthalen-1-yl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(7-fluoro-6-naphthalen-1-yl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 165386052 |
| Molecular Formula | C38H23FIrN2O-2 |
| Molecular Weight | 734.83 g/mol |
| Exact Mass | 735.14 |
| IUPAC Name | 2-(7-fluoro-6-naphthalen-1-yl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | Fc1ccc2c(oc3c(-c4ccccn4)[c-]ccc32)c1-c1cccc2ccccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H15FNO.C11H8N.Ir/c28-23-15-14-21-20-11-6-12-22(24-13-3-4-16-29-24)26(20)30-27(21)25(23)19-10-5-8-17-7-1-2-9-18(17)19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-11,13-16H;1-6,8-9H;/q2*-1; |
| InChIKey | QXTNMFVQIWLXTA-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.83 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|