C40H33FIrN2O-2 — CID 164798183
4-(2,2-dimethylpropyl)-5-methyl-2-phenylpyridine;2-(7-fluoro-6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium (PubChem CID 164798183) has the molecular formula C40H33FIrN2O-2 and a molecular weight of 768.93 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-5-methyl-2-phenylpyridine;2-(7-fluoro-6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium.
| Compound Name | 4-(2,2-dimethylpropyl)-5-methyl-2-phenylpyridine;2-(7-fluoro-6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium |
|---|---|
| PubChem CID | 164798183 |
| Molecular Formula | C40H33FIrN2O-2 |
| Molecular Weight | 768.93 g/mol |
| Exact Mass | 769.22 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-5-methyl-2-phenylpyridine;2-(7-fluoro-6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium |
| SMILES | Cc1cnc(-c2[c-]cccc2)cc1CC(C)(C)C.Fc1ccc2c(oc3c(-c4ccccn4)[c-]ccc32)c1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C23H13FNO.C17H20N.Ir/c24-19-13-12-17-16-9-6-10-18(20-11-4-5-14-25-20)22(16)26-23(17)21(19)15-7-2-1-3-8-15;1-13-12-18-16(14-8-6-5-7-9-14)10-15(13)11-17(2,3)4;/h1-9,11-14H;5-8,10,12H,11H2,1-4H3;/q2*-1; |
| InChIKey | PLPFHIAYBJTOGJ-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.93 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|